Online Database of Chemicals from Around the World
|
CAS#: 68091-86-1 Product: Bis(Perbromophenyl) Maleate No suppilers available for the product. |
| Name | Bis(Perbromophenyl) Maleate |
|---|---|
| Synonyms | (E)-But-2-Enedioic Acid Bis(2,3,4,5,6-Pentabromophenyl) Ester; 2-Butenedioic Acid (2E)-, Bis(Pentabromophenyl) Ester; Bis(Pentabromophenyl) Fumarate |
| Molecular Structure |  |
| Molecular Formula | C16H2Br10O4 |
| Molecular Weight | 1057.23 |
| CAS Registry Number | 68091-86-1 |
| EINECS | 268-451-8 |
| SMILES | C1(=C(Br)C(=C(C(=C1Br)Br)OC(=O)\C=C\C(=O)OC2=C(Br)C(=C(C(=C2Br)Br)Br)Br)Br)Br |
| InChI | 1S/C16H2Br10O4/c17-5-7(19)11(23)15(12(24)8(5)20)29-3(27)1-2-4(28)30-16-13(25)9(21)6(18)10(22)14(16)26/h1-2H/b2-1+ |
| InChIKey | DXPKDGZNZOIMJZ-OWOJBTEDSA-N |
| Density | 2.774g/cm3 (Cal.) |
|---|---|
| Boiling point | 758.715°C at 760 mmHg (Cal.) |
| Flash point | 412.656°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(Perbromophenyl) Maleate |