Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| MolMall | Switzerland | Inquire | ||
|---|---|---|---|---|
|
+41 (21) 802-1834 | |||
|
info@molmall.net | |||
| Chemical manufacturer since 2012 | ||||
| Name | Methyl 2-ethyl-3-methyl-3H-indole-3-carboxylate |
|---|---|
| Synonyms | methyl 2-ethyl-3-methyl-3H-indole-3-carboxylate |
| Molecular Structure |  |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.26 |
| CAS Registry Number | 681477-48-5 |
| SMILES | O=C(OC)C/1(c2ccccc2\N=C\1CC)C |
| InChI | 1S/C13H15NO2/c1-4-11-13(2,12(15)16-3)9-7-5-6-8-10(9)14-11/h5-8H,4H2,1-3H3 |
| InChIKey | KDTDHNYUGROEJL-UHFFFAOYSA-N |
| Density | 1.108g/cm3 (Cal.) |
|---|---|
| Melting point | 71-73°C (Expl.) |
| Boiling point | 301.834°C at 760 mmHg (Cal.) |
| Flash point | 124.078°C (Cal.) |
| Refractive index | 1.552 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 2-ethyl-3-methyl-3H-indole-3-carboxylate |