Online Database of Chemicals from Around the World
|
CAS#: 6815-48-1 Product: 11-Keto-Pregnanediol No suppilers available for the product. |
| Name | 11-Keto-Pregnanediol |
|---|---|
| Synonyms | Pregnan-11-One, 3,20-Dihydroxy-, (3Alpha,5Beta,20S)-; 3Alpha,20-Alpha-Dihydroxy-5Beta-Pregnan-11-One; 11-Keto-Pregnanediol |
| Molecular Structure |  |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 |
| CAS Registry Number | 6815-48-1 |
| SMILES | [C@]24([C@H]([C@@H]1CC[C@H]3[C@@]([C@H]1C(C2)=O)(CC[C@@H](O)C3)C)CC[C@@H]4[C@@H](O)C)C |
| InChI | 1S/C21H34O3/c1-12(22)16-6-7-17-15-5-4-13-10-14(23)8-9-20(13,2)19(15)18(24)11-21(16,17)3/h12-17,19,22-23H,4-11H2,1-3H3/t12-,13+,14+,15-,16+,17-,19+,20-,21+/m0/s1 |
| InChIKey | OFWWSHNAQHDEIN-GKBUJGRRSA-N |
| Density | 1.112g/cm3 (Cal.) |
|---|---|
| Boiling point | 472.482°C at 760 mmHg (Cal.) |
| Flash point | 253.662°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 11-Keto-Pregnanediol |