Online Database of Chemicals from Around the World
|
CAS#: 68155-50-0 Product: 3,4-Bisisopropylphenol No suppilers available for the product. |
| Name | 3,4-Bisisopropylphenol |
|---|---|
| Synonyms | 3,4-Diisopropylphenol; Phenol, 3,4-Bis(1-Methylethyl)-; 3,4-Bisisopropylphenol |
| Molecular Structure |  |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 |
| CAS Registry Number | 68155-50-0 |
| EINECS | 268-964-7 |
| SMILES | C1=CC(=C(C=C1O)C(C)C)C(C)C |
| InChI | 1S/C12H18O/c1-8(2)11-6-5-10(13)7-12(11)9(3)4/h5-9,13H,1-4H3 |
| InChIKey | VTJCIWXYZXSECW-UHFFFAOYSA-N |
| Density | 0.948g/cm3 (Cal.) |
|---|---|
| Boiling point | 260.229°C at 760 mmHg (Cal.) |
| Flash point | 118.373°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4-Bisisopropylphenol |