Online Database of Chemicals from Around the World
| Name | Dimethyl Dihydrogen Diphosphate |
|---|---|
| Synonyms | (Hydroxy-Methoxy-Phosphoryl) Methyl Hydrogen Phosphate; Dimethyl Dihydrogen Diphosphate; Dimethyl Pyrophosphate |
| Molecular Structure |  |
| Molecular Formula | C2H8O7P2 |
| Molecular Weight | 206.03 |
| CAS Registry Number | 68155-93-1 (26644-00-8) |
| EINECS | 268-993-5 |
| SMILES | CO[P](O[P](OC)(O)=O)(O)=O |
| InChI | 1S/C2H8O7P2/c1-7-10(3,4)9-11(5,6)8-2/h1-2H3,(H,3,4)(H,5,6) |
| InChIKey | BPNLLIHZSAFABG-UHFFFAOYSA-N |
| Density | 1.662g/cm3 (Cal.) |
|---|---|
| Boiling point | 313.483°C at 760 mmHg (Cal.) |
| Flash point | 143.39°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethyl Dihydrogen Diphosphate |
