Online Database of Chemicals from Around the World
|
CAS#: 68200-23-7 Product: 14-Fluororetinal No suppilers available for the product. |
| Name | 14-Fluororetinal |
|---|---|
| Synonyms | 14-Fluororetinal; Retinal, 14-Fluoro-, 13-Cis- |
| Molecular Structure |  |
| Molecular Formula | C20H27FO |
| Molecular Weight | 302.43 |
| CAS Registry Number | 68200-23-7 |
| SMILES | CC(=C(/C=O)F)/C=C/C=C(C)\C=C\C1=C(C)CCCC1(C)C |
| InChI | 1S/C20H27FO/c1-15(8-6-9-17(3)19(21)14-22)11-12-18-16(2)10-7-13-20(18,4)5/h6,8-9,11-12,14H,7,10,13H2,1-5H3/b9-6+,12-11+,15-8-,19-17+ |
| InChIKey | KCEVSZISNGMYIB-TVZGSSNYSA-N |
| Density | 0.991g/cm3 (Cal.) |
|---|---|
| Boiling point | 431.213°C at 760 mmHg (Cal.) |
| Flash point | 239.324°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 14-Fluororetinal |