Online Database of Chemicals from Around the World
|
CAS#: 68228-10-4 Product: 2,6-Diethylquinoline No suppilers available for the product. |
| Name | 2,6-Diethylquinoline |
|---|---|
| Synonyms | Diethylquinoline; Quinoline, Diethyl- |
| Molecular Structure |  |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 |
| CAS Registry Number | 68228-10-4 |
| EINECS | 269-406-5 |
| SMILES | C1=C(C=CC2=C1C=CC(=N2)CC)CC |
| InChI | 1S/C13H15N/c1-3-10-5-8-13-11(9-10)6-7-12(4-2)14-13/h5-9H,3-4H2,1-2H3 |
| InChIKey | KXXUQZRDMOQZFD-UHFFFAOYSA-N |
| Density | 1.016g/cm3 (Cal.) |
|---|---|
| Boiling point | 285.59°C at 760 mmHg (Cal.) |
| Flash point | 116.004°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,6-Diethylquinoline |