|
CAS#: 68239-84-9 Product: Bis[N,N-Diethyl-m-aminophenol] Sulphate No suppilers available for the product. |
| Name | Bis[N,N-Diethyl-m-aminophenol] Sulphate |
|---|---|
| Synonyms | 3-(Dimethylamino)Phenol Sulfate; Bis((Diethylhydroxyphenyl)Ammonium) Sulphate |
| Molecular Structure | ![]() |
| Molecular Formula | C20H32N2O6S |
| Molecular Weight | 428.54 |
| CAS Registry Number | 68239-84-9 |
| EINECS | 269-478-8 |
| SMILES | O=[S](=O)(O)O.C1=C(N(CC)CC)C=CC=C1O.C(N(C2=CC(=CC=C2)O)CC)C |
| InChI | 1S/2C10H15NO.H2O4S/c2*1-3-11(4-2)9-6-5-7-10(12)8-9;1-5(2,3)4/h2*5-8,12H,3-4H2,1-2H3;(H2,1,2,3,4) |
| InChIKey | UBHOMCCCACORIM-UHFFFAOYSA-N |
| Boiling point | 278°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 139.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis[N,N-Diethyl-m-aminophenol] Sulphate |