Online Database of Chemicals from Around the World
|
CAS#: 68269-87-4 Product: Modhephene No suppilers available for the product. |
| Name | Modhephene |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.35 |
| CAS Registry Number | 68269-87-4 |
| SMILES | [C@@H]1(C23C(CC1)(CCC2)C(C=C3C)(C)C)C |
| InChI | 1S/C15H24/c1-11-6-9-14-7-5-8-15(11,14)12(2)10-13(14,3)4/h10-11H,5-9H2,1-4H3/t11-,14?,15?/m1/s1 |
| InChIKey | APGXRXFCBZKIAN-VCANKDNSSA-N |
| Density | 0.952g/cm3 (Cal.) |
|---|---|
| Boiling point | 267.493°C at 760 mmHg (Cal.) |
| Flash point | 113.816°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Modhephene |