Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Methyl 3-oxo-L-leucinate |
|---|---|
| Synonyms | (S)-methyl 2-amino-4-methyl-3-oxopentanoate |
| Molecular Structure |  |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.18 |
| CAS Registry Number | 68277-02-1 |
| SMILES | CC(C)C(=O)[C@@H](C(=O)OC)N |
| InChI | 1S/C7H13NO3/c1-4(2)6(9)5(8)7(10)11-3/h4-5H,8H2,1-3H3/t5-/m0/s1 |
| InChIKey | SBTGPLHMJJAOGM-YFKPBYRVSA-N |
| Density | 1.067g/cm3 (Cal.) |
|---|---|
| Boiling point | 201.188°C at 760 mmHg (Cal.) |
| Flash point | 59.149°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 3-oxo-L-leucinate |