Online Database of Chemicals from Around the World
|
CAS#: 6831-16-9 Product: Aristol-9-ene No suppilers available for the product. |
| Name | Aristol-9-ene |
|---|---|
| Synonyms | (-)-9-aristolene |
| Molecular Structure |  |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.35 |
| CAS Registry Number | 6831-16-9 |
| SMILES | C[C@@H]2CCC\C1=C\C[C@@H]3[C@H]([C@]12C)C3(C)C |
| InChI | 1S/C15H24/c1-10-6-5-7-11-8-9-12-13(14(12,2)3)15(10,11)4/h8,10,12-13H,5-7,9H2,1-4H3/t10-,12-,13+,15+/m1/s1 |
| InChIKey | FOBXOZMHEKILEY-PBOSXPJTSA-N |
| Density | 0.948g/cm3 (Cal.) |
|---|---|
| Boiling point | 259.903°C at 760 mmHg (Cal.) |
| Flash point | 99.345°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Aristol-9-ene |