| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() | www.bocsci.com | |||
![]() | +1 (631) 485-4226 | |||
![]() | +1 (631) 614-7828 | |||
![]() | info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink Standard supplier since 2010 | ||||
| Classification | API >> Inhibitor drug |
|---|---|
| Name | 2-(4-(4-Chlorophenyl)-1-oxophthalazin-2(1H)-yl)-N-(4-fluorophenyl)acetamide |
| Synonyms | WAY-323096 |
| Molecular Structure | ![]() |
| Molecular Formula | C22H15ClFN3O2 |
| Molecular Weight | 407.82 |
| CAS Registry Number | 684234-60-4 |
| SMILES | C1=CC=C2C(=C1)C(=NN(C2=O)CC(=O)NC3=CC=C(C=C3)F)C4=CC=C(C=C4)Cl |
| Solubility | 5.43 mg/L (25 °C water) |
|---|---|
| Density | 1.4±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.656, Calc.* |
| Melting point | 264.44 °C |
| Boiling Point | 610.97 °C |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302-H315-H319 Details |
| Safety Statements | P501-P270-P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313-P301+P312+P330 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 2-(4-(4-Chlorophenyl)-1-oxophthalazin-2(1H)-yl)-N-(4-fluorophenyl)acetamide |