| Sigma-Aldrich, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| chemBlink standard supplier since 2018 | ||||
| Classification | Catalysts and additives >> Polymer |
|---|---|
| Name | Duolite C-26 Ion-Exchange Resin |
| Synonyms | Sodium; 1,2-Divinylbenzene; Styrene; Sodium; 1,2-Di(Ethenyl)Benzene; Ethenylbenzene |
| Molecular Formula | C18H18Na |
| Molecular Weight | 257.33 |
| CAS Registry Number | 68441-33-8 |
| SMILES | C1=C(C(=CC=C1)C=C)C=C.C2=C(C=CC=C2)C=C.[Na+] |
| InChI | 1S/C10H10.C8H8.Na/c1-3-9-7-5-6-8-10(9)4-2;1-2-8-6-4-3-5-7-8;/h3-8H,1-2H2;2-7H,1H2;/q;;+1 |
| InChIKey | ZWZSXPSZPITJQN-UHFFFAOYSA-N |
| Boiling point | 207.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 71.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Duolite C-26 Ion-Exchange Resin |