Online Database of Chemicals from Around the World
|
CAS#: 68527-46-8 Product: 3-Nitrophenethyl Acetate No suppilers available for the product. |
| Name | 3-Nitrophenethyl Acetate |
|---|---|
| Synonyms | Acetic Acid 2-(3-Nitrophenyl)Ethyl Ester; 2-(3-Nitrophenyl)Ethyl Ethanoate; Benzeneethanol, 3-Nitro-, Acetate (Ester) |
| Molecular Structure |  |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 |
| CAS Registry Number | 68527-46-8 |
| EINECS | 271-268-6 |
| SMILES | C1=CC(=CC(=C1)[N+]([O-])=O)CCOC(=O)C |
| InChI | 1S/C10H11NO4/c1-8(12)15-6-5-9-3-2-4-10(7-9)11(13)14/h2-4,7H,5-6H2,1H3 |
| InChIKey | DHCRSUDNZBCHMQ-UHFFFAOYSA-N |
| Density | 1.226g/cm3 (Cal.) |
|---|---|
| Boiling point | 328.785°C at 760 mmHg (Cal.) |
| Flash point | 148.534°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Nitrophenethyl Acetate |