Online Database of Chemicals from Around the World
|
CAS#: 68527-69-5 Product: 5,6-Dimethylquinolin-8-Amine No suppilers available for the product. |
| Name | 5,6-Dimethylquinolin-8-Amine |
|---|---|
| Synonyms | 5,6-Dimethyl-8-Quinolinamine; (5,6-Dimethyl-8-Quinolyl)Amine; 8-Amino-5,6-Dimethylquinoline |
| Molecular Structure |  |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 |
| CAS Registry Number | 68527-69-5 |
| EINECS | 271-277-5 |
| SMILES | C1=CC=C2C(=N1)C(=CC(=C2C)C)N |
| InChI | 1S/C11H12N2/c1-7-6-10(12)11-9(8(7)2)4-3-5-13-11/h3-6H,12H2,1-2H3 |
| InChIKey | PCFUCAPVUDEZAR-UHFFFAOYSA-N |
| Density | 1.136g/cm3 (Cal.) |
|---|---|
| Boiling point | 345.572°C at 760 mmHg (Cal.) |
| Flash point | 189.659°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 5,6-Dimethylquinolin-8-Amine |