Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (1S,2R,3S)-2,3-Dimethylcyclohexanamine |
|---|---|
| Synonyms | (1S,2R,3S)-2,3-dimethylcyclohexanamine |
| Molecular Structure |  |
| Molecular Formula | C8H17N |
| Molecular Weight | 127.23 |
| CAS Registry Number | 685502-22-1 |
| SMILES | N[C@H]1CCC[C@H](C)[C@H]1C |
| InChI | 1S/C8H17N/c1-6-4-3-5-8(9)7(6)2/h6-8H,3-5,9H2,1-2H3/t6-,7+,8-/m0/s1 |
| InChIKey | LKWOOKWVBNSLGN-RNJXMRFFSA-N |
| Density | 0.826g/cm3 (Cal.) |
|---|---|
| Boiling point | 160.348°C at 760 mmHg (Cal.) |
| Flash point | 30.014°C (Cal.) |
| Refractive index | 1.441 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1S,2R,3S)-2,3-Dimethylcyclohexanamine |