Online Database of Chemicals from Around the World
|
CAS#: 68556-21-8 Product: Methyl 2-(Ethylideneamino)Benzoate No suppilers available for the product. |
| Name | Methyl 2-(Ethylideneamino)Benzoate |
|---|---|
| Synonyms | 2-(Ethylideneamino)Benzoic Acid Methyl Ester; Benzoic Acid, 2-(Ethylideneamino)-, Methyl Ester |
| Molecular Structure |  |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 |
| CAS Registry Number | 68556-21-8 |
| EINECS | 271-480-9 |
| SMILES | C1=CC(=C(C=C1)C(=O)OC)N=CC |
| InChI | 1S/C10H11NO2/c1-3-11-9-7-5-4-6-8(9)10(12)13-2/h3-7H,1-2H3 |
| InChIKey | CARKMBGHKLICNI-UHFFFAOYSA-N |
| Density | 1.032g/cm3 (Cal.) |
|---|---|
| Boiling point | 299.23°C at 760 mmHg (Cal.) |
| Flash point | 141.277°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 2-(Ethylideneamino)Benzoate |