|
CAS#: 68648-89-5 Product: Butylene-Ethylene-Styrene Copolymer No suppilers available for the product. |
| Classification | Catalysts and additives >> Polymer |
|---|---|
| Name | Butylene-Ethylene-Styrene Copolymer |
| Synonyms | Isoprene; Vinylbenzene; Ls-181722; 432415_Aldrich |
| Molecular Formula | C13H16 |
| Molecular Weight | 172.27 |
| CAS Registry Number | 68648-89-5 |
| SMILES | C1=C(C=CC=C1)C=C.CC(C=C)=C |
| InChI | 1S/C8H8.C5H8/c1-2-8-6-4-3-5-7-8;1-4-5(2)3/h2-7H,1H2;4H,1-2H2,3H3 |
| InChIKey | ROGIWVXWXZRRMZ-UHFFFAOYSA-N |
| Boiling point | 145.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 31.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Butylene-Ethylene-Styrene Copolymer |