|
CAS#: 68692-83-1 Product: 2-Ethyl-2-(4-Tolyl)Malonamide No suppilers available for the product. |
| Name | 2-Ethyl-2-(4-Tolyl)Malonamide |
|---|---|
| Synonyms | 2-Ethyl-2-(4-Methylphenyl)Malonamide; Propanediamide, 2-Ethyl-2-(4-Methylphenyl)-; St5441878 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 |
| CAS Registry Number | 68692-83-1 |
| EINECS | 272-083-3 |
| SMILES | C1=C(C(C(N)=O)(C(N)=O)CC)C=CC(=C1)C |
| InChI | 1S/C12H16N2O2/c1-3-12(10(13)15,11(14)16)9-6-4-8(2)5-7-9/h4-7H,3H2,1-2H3,(H2,13,15)(H2,14,16) |
| InChIKey | OUDOLYGETKWQIK-UHFFFAOYSA-N |
| Density | 1.156g/cm3 (Cal.) |
|---|---|
| Boiling point | 452.114°C at 760 mmHg (Cal.) |
| Flash point | 227.231°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Ethyl-2-(4-Tolyl)Malonamide |