Online Database of Chemicals from Around the World
|
CAS#: 68856-21-3 Product: Octahydro-3,5,5,8,8-Pentamethylnaphthalene-2(1H)-One No suppilers available for the product. |
| Name | Octahydro-3,5,5,8,8-Pentamethylnaphthalene-2(1H)-One |
|---|---|
| Synonyms | 3,5,5,8,8-Pentamethyldecalin-2-One; 3,5,5,8,8-Pentamethyl-2-Decalinone; St5443331 |
| Molecular Structure |  |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 |
| CAS Registry Number | 68856-21-3 |
| EINECS | 272-504-0 |
| SMILES | CC1(C2C(C(C)(C)CC1)CC(=O)C(C2)C)C |
| InChI | 1S/C15H26O/c1-10-8-11-12(9-13(10)16)15(4,5)7-6-14(11,2)3/h10-12H,6-9H2,1-5H3 |
| InChIKey | HAPDRSVNEVCRKW-UHFFFAOYSA-N |
| Density | 0.883g/cm3 (Cal.) |
|---|---|
| Boiling point | 283.934°C at 760 mmHg (Cal.) |
| Flash point | 118.004°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Octahydro-3,5,5,8,8-Pentamethylnaphthalene-2(1H)-One |