Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054/ | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2,6-Bis[(dimethylamino)methyl]-3-pyridinol 1-oxide |
|---|---|
| Synonyms | 2,6-bis((dimethylamino)methyl)-3-hydroxypyridine 1-oxide |
| Molecular Structure | ![CAS#: 688728-28-1， 2,6-Bis[(dimethylamino)methyl]-3-pyridinol 1-oxide](/moreStructures/688728-28-1.gif) |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 |
| CAS Registry Number | 688728-28-1 |
| SMILES | CN(C)Cc1ccc(c([n+]1[O-])CN(C)C)O |
| InChI | 1S/C11H19N3O2/c1-12(2)7-9-5-6-11(15)10(14(9)16)8-13(3)4/h5-6,15H,7-8H2,1-4H3 |
| InChIKey | NQONFCLMDLUOAS-UHFFFAOYSA-N |
| Density | 1.101g/cm3 (Cal.) |
|---|---|
| Boiling point | 380.521°C at 760 mmHg (Cal.) |
| Flash point | 183.933°C (Cal.) |
| Refractive index | 1.533 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,6-Bis[(dimethylamino)methyl]-3-pyridinol 1-oxide |