Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Sigma-Aldrich, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+86 (21) 6141-5566 / 800-819-3336 | |||
|
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | N-(2-Ethylphenyl)-3-Hydroxy-2-Naphthalenecarboxamide |
|---|---|
| Synonyms | N-(2-Ethylphenyl)-3-Hydroxy-Naphthalene-2-Carboxamide; N-(2-Ethylphenyl)-3-Hydroxy-2-Naphthalenecarboxamide; N-(2-Ethylphenyl)-3-Hydroxy-2-Naphthamide |
| Molecular Structure |  |
| Molecular Formula | C19H17NO2 |
| Molecular Weight | 291.35 |
| CAS Registry Number | 68911-98-8 |
| EINECS | 272-795-4 |
| SMILES | C1=C3C(=CC(=C1C(NC2=C(C=CC=C2)CC)=O)O)C=CC=C3 |
| InChI | 1S/C19H17NO2/c1-2-13-7-5-6-10-17(13)20-19(22)16-11-14-8-3-4-9-15(14)12-18(16)21/h3-12,21H,2H2,1H3,(H,20,22) |
| InChIKey | SVJPZKBLNJTZNY-UHFFFAOYSA-N |
| Density | 1.247g/cm3 (Cal.) |
|---|---|
| Boiling point | 414.951°C at 760 mmHg (Cal.) |
| Flash point | 204.755°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2-Ethylphenyl)-3-Hydroxy-2-Naphthalenecarboxamide |