|
CAS#: 68955-22-6 Product: Titanium(IV) n-Butoxide Isopropoxide No suppilers available for the product. |
| Name | Titanium(IV) n-Butoxide Isopropoxide |
|---|---|
| Synonyms | Butoxyisopropoxytitanium; Titanium, Bu Alc. Iso-Pr Alc. Complexes |
| Molecular Structure | ![]() |
| Molecular Formula | C7H18O2Ti |
| Molecular Weight | 182.12 |
| CAS Registry Number | 68955-22-6 |
| EINECS | 273-260-8 |
| SMILES | [Ti++].[OH-]CCCC.[OH-]C(C)C |
| InChI | 1S/C4H10O.C3H8O.Ti/c1-2-3-4-5;1-3(2)4;/h5H,2-4H2,1H3;3-4H,1-2H3;/q2*-1;+2 |
| InChIKey | LYXAGRKQLQNSTD-UHFFFAOYSA-N |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Titanium(IV) n-Butoxide Isopropoxide |