|
CAS#: 68957-62-0 Product: N-Ethyl-1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-Pentadecafluoroheptane-1-Sulphonamide No suppilers available for the product. |
| Name | N-Ethyl-1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-Pentadecafluoroheptane-1-Sulphonamide |
|---|---|
| Synonyms | N-Ethyl-1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-Pentadecafluoro-Heptane-1-Sulfonamide; 1-Heptanesulfonamide, N-Ethyl-1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-Pentadecafluoro- |
| Molecular Structure | ![]() |
| Molecular Formula | C9H6F15NO2S |
| Molecular Weight | 477.19 |
| CAS Registry Number | 68957-62-0 |
| EINECS | 273-354-9 |
| SMILES | C(N[S](=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C |
| InChI | 1S/C9H6F15NO2S/c1-2-25-28(26,27)9(23,24)7(18,19)5(14,15)3(10,11)4(12,13)6(16,17)8(20,21)22/h25H,2H2,1H3 |
| InChIKey | WMOMXEHEPXLIAV-UHFFFAOYSA-N |
| Density | 1.651g/cm3 (Cal.) |
|---|---|
| Boiling point | 231°C at 760 mmHg (Cal.) |
| Flash point | 93.506°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Ethyl-1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-Pentadecafluoroheptane-1-Sulphonamide |