Online Database of Chemicals from Around the World
|
CAS#: 68971-87-9 Product: Tributyl(2-methylphenyl)stannane No suppilers available for the product. |
| Name | Tributyl(2-methylphenyl)stannane |
|---|---|
| Synonyms | 2-Methyl(tri-n-butylstannyl)benzene 95+%; TRIBUTYL(2-METHYLPHENYL)STANNANE |
| Molecular Structure |  |
| Molecular Formula | C19H34Sn |
| Molecular Weight | 381.18 |
| CAS Registry Number | 68971-87-9 |
| SMILES | c1(ccccc1C)[Sn](CCCC)(CCCC)CCCC |
| InChI | 1S/C7H7.3C4H9.Sn/c1-7-5-3-2-4-6-7;3*1-3-4-2;/h2-5H,1H3;3*1,3-4H2,2H3; |
| InChIKey | UNPPRLNRJXOGFB-UHFFFAOYSA-N |
| Boiling point | 383.879°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 189.983°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tributyl(2-methylphenyl)stannane |