Online Database of Chemicals from Around the World
|
CAS#: 6899-64-5 Product: (-)-Caaverine No suppilers available for the product. |
| Name | (-)-Caaverine |
|---|---|
| Synonyms | C09368; Noraporphin-1-Ol, 2-Methoxy-; 1-Hydroxy-2-Methoxynoraporphine |
| Molecular Structure |  |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 |
| CAS Registry Number | 6899-64-5 |
| SMILES | [C@@H]23C1=C(C(=C(C=C1CCN2)OC)O)C4=C(C3)C=CC=C4 |
| InChI | 1S/C17H17NO2/c1-20-14-9-11-6-7-18-13-8-10-4-2-3-5-12(10)16(15(11)13)17(14)19/h2-5,9,13,18-19H,6-8H2,1H3/t13-/m1/s1 |
| InChIKey | DUSFBAYEYGRYOT-CYBMUJFWSA-N |
| Density | 1.236g/cm3 (Cal.) |
|---|---|
| Boiling point | 472.522°C at 760 mmHg (Cal.) |
| Flash point | 239.573°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (-)-Caaverine |