Online Database of Chemicals from Around the World
|
CAS#: 6900-81-8 Product: Apohemanthamine No suppilers available for the product. |
| Name | Apohemanthamine |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 |
| CAS Registry Number | 6900-81-8 |
| SMILES | [C@H]12N6C[C@@H]3O[C@@H](C1)C=CC23C5=CC4=C(OCO4)C=C5C6 |
| InChI | 1S/C16H15NO3/c1-2-16-11-5-13-12(18-8-19-13)3-9(11)6-17-7-15(16)20-10(1)4-14(16)17/h1-3,5,10,14-15H,4,6-8H2/t10-,14+,15+,16?/m1/s1 |
| InChIKey | QMGIUGSXVRJVRE-KFMVOITCSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 423.5±45.0°C at 760 mmHg (Cal.) |
| Flash point | 134.3±25.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Apohemanthamine |