| RIA International LLC | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (973) 581-1282/ | |||
![]() |
marketing@riausa.net,nj@riausa.net | |||
| Chemical distributor | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | Disodium 2-(N-methylcarbamimidamido)ethyl phosphate |
|---|---|
| Synonyms | Creatinol O-phosphate Disodium |
| Molecular Structure | ![]() |
| Molecular Formula | C4H10N3Na2O4P |
| Molecular Weight | 241.09 |
| CAS Registry Number | 6903-80-6 |
| SMILES | CN(CCOP(=O)(O[Na])O[Na])C(=N)N |
| InChI | 1S/C4H12N3O4P.2Na/c1-7(4(5)6)2-3-11-12(8,9)10;;/h2-3H2,1H3,(H3,5,6)(H2,8,9,10);;/q;2*+1/p-2 |
| InChIKey | SJDIYXXTYDHARQ-UHFFFAOYSA-L |
| Market Analysis Reports |
| List of Reports Available for Disodium 2-(N-methylcarbamimidamido)ethyl phosphate |