Online Database of Chemicals from Around the World
| Beta Pharma Scientific, Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (203) 315-5062 / (877) 786-1922 | |||
 |
sales@betapharma.com, | |||
| Chemical manufacturer | ||||
| Paragos e. K. | Germany | Inquire | ||
|---|---|---|---|---|
|
+49 2330-8079751 | |||
|
sales@paragos.de | |||
| Chemical manufacturer since 2001 | ||||
| Name | 4-Methyl-1-naphthalenecarboximidamide |
|---|---|
| Synonyms | 4-Methyl-naphthalene-1-carboxamidine; 4-methylnaphthalene-1-carboximidamide |
| Molecular Structure |  |
| Molecular Formula | C12H12N2 |
| Molecular Weight | 184.24 |
| CAS Registry Number | 69228-21-3 |
| SMILES | CC1=CC=C(C2=CC=CC=C12)C(=N)N |
| InChI | rd-copy-button" onmouseover="ClipboardCopyInit(this, |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 338.4±35.0°C at 760 mmHg (Cal.) |
| Flash point | 158.5±25.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methyl-1-naphthalenecarboximidamide |