Online Database of Chemicals from Around the World
|
CAS#: 69239-38-9 Product: N-(2,5-Dimethoxyphenethyl)-N-Methylurea No suppilers available for the product. |
| Name | N-(2,5-Dimethoxyphenethyl)-N-Methylurea |
|---|---|
| Synonyms | 1-[2-(2,5-Dimethoxyphenyl)Ethyl]-1-Methyl-Urea; 2,5-Dimethoxy-Beta-Phenylethylmethylurea; Brn 3352701 |
| Molecular Structure |  |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 |
| CAS Registry Number | 69239-38-9 |
| SMILES | C1=C(C(=CC(=C1)OC)CCN(C(=O)N)C)OC |
| InChI | 1S/C12H18N2O3/c1-14(12(13)15)7-6-9-8-10(16-2)4-5-11(9)17-3/h4-5,8H,6-7H2,1-3H3,(H2,13,15) |
| InChIKey | NTYKFTHJEUWDOO-UHFFFAOYSA-N |
| Density | 1.128g/cm3 (Cal.) |
|---|---|
| Boiling point | 384.618°C at 760 mmHg (Cal.) |
| Flash point | 186.411°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2,5-Dimethoxyphenethyl)-N-Methylurea |