Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
|
+380 (44) 522-2458 | |||
|
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 4-[(4-Aminophenyl)Azo]Benzoic Acid |
|---|---|
| Synonyms | 4-(4-Aminophenyl)Azobenzoic Acid; Benzoic Acid, 4-((4-Aminophenyl)Azo)-; Ai3-52563 |
| Molecular Structure | ![CAS#: 6925-48-0， 4-[(4-Aminophenyl)Azo]Benzoic Acid](/moreStructures/6925-48-0.gif) |
| Molecular Formula | C13H11N3O2 |
| Molecular Weight | 241.25 |
| CAS Registry Number | 6925-48-0 |
| EINECS | 230-047-4 |
| SMILES | C1=C(C=CC(=C1)N=NC2=CC=C(C=C2)C(=O)O)N |
| InChI | 1S/C13H11N3O2/c14-10-3-7-12(8-4-10)16-15-11-5-1-9(2-6-11)13(17)18/h1-8H,14H2,(H,17,18) |
| InChIKey | KJNBDJZDRNLJJG-UHFFFAOYSA-N |
| Density | 1.299g/cm3 (Cal.) |
|---|---|
| Boiling point | 485.438°C at 760 mmHg (Cal.) |
| Flash point | 247.384°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[(4-Aminophenyl)Azo]Benzoic Acid |