Online Database of Chemicals from Around the World
| Princeton BioMolecular Research, Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (732) 355-9920 | |||
 |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| Name | Ethyl 2',4'-dimethyl-4-biphenylcarboxylate |
|---|---|
| Synonyms | Ethyl 2',4'-dimethyl[1,1'-biphenyl]-4-carboxylate #; ethyl 2',4'-dimethyl-1,1'-biphenyl-4-carboxylate |
| Molecular Structure |  |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.32 |
| CAS Registry Number | 69299-53-2 |
| SMILES | O=C(OCC)c1ccc(cc1)c2ccc(cc2C)C |
| InChI | 1S/C17H18O2/c1-4-19-17(18)15-8-6-14(7-9-15)16-10-5-12(2)11-13(16)3/h5-11H,4H2,1-3H3 |
| InChIKey | XTBQKEVAFPLVMZ-UHFFFAOYSA-N |
| Density | 1.052g/cm3 (Cal.) |
|---|---|
| Boiling point | 363.008°C at 760 mmHg (Cal.) |
| Flash point | 152.839°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 2',4'-dimethyl-4-biphenylcarboxylate |