Online Database of Chemicals from Around the World
| Carbosynth China Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (512) 6260-5585 | |||
 |
sales@carbosynth.com | |||
 |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2016 | ||||
| Name | D-Fucosylamine |
|---|---|
| Synonyms | (3R,4S,5R,6R)-2-Amino-6-Methyl-Tetrahydropyran-3,4,5-Triol; (3R,4S,5R,6R)-2-Amino-6-Methyltetrahydropyran-3,4,5-Triol; (3R,4S,5R,6R)-2-Amino-6-Methyl-Oxane-3,4,5-Triol |
| Molecular Structure |  |
| Molecular Formula | C6H13NO4 |
| Molecular Weight | 163.17 |
| CAS Registry Number | 6931-59-5 |
| SMILES | [C@@H]1(C(N)O[C@@H]([C@@H]([C@@H]1O)O)C)O |
| InChI | 1S/C6H13NO4/c1-2-3(8)4(9)5(10)6(7)11-2/h2-6,8-10H,7H2,1H3/t2-,3+,4+,5-,6?/m1/s1 |
| InChIKey | UTVXFQMLZSPQLB-SVZMEOIVSA-N |
| Density | 1.406g/cm3 (Cal.) |
|---|---|
| Boiling point | 331.508°C at 760 mmHg (Cal.) |
| Flash point | 154.291°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for D-Fucosylamine |