Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3,4,7,8-Tetrahydroxy-2-chromanone |
|---|---|
| Synonyms | 3,4,7,8-tetrahydroxychroman-2-one |
| Molecular Structure |  |
| Molecular Formula | C9H8O6 |
| Molecular Weight | 212.16 |
| CAS Registry Number | 693250-21-4 |
| SMILES | c1cc(c(c2c1C(C(C(=O)O2)O)O)O)O |
| InChI | 1S/C9H8O6/c10-4-2-1-3-5(11)7(13)9(14)15-8(3)6(4)12/h1-2,5,7,10-13H |
| InChIKey | CZXTYMVGTQHJAA-UHFFFAOYSA-N |
| Density | 1.851g/cm3 (Cal.) |
|---|---|
| Boiling point | 528.699°C at 760 mmHg (Cal.) |
| Flash point | 220.887°C (Cal.) |
| Refractive index | 1.759 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4,7,8-Tetrahydroxy-2-chromanone |