Online Database of Chemicals from Around the World
| Carbosynth China Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (512) 6260-5585 | |||
 |
sales@carbosynth.com | |||
 |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2016 | ||||
| Name | 6-Deoxy-3-C-methyl-D-Gulose |
|---|---|
| Synonyms | (2R,3R,4S,5R)-2,3,4,5-Tetrahydroxy-3-Methyl-Hexanal; Virenose; 6-Deoxy-C-Methylgulose |
| Molecular Structure |  |
| Molecular Formula | C7H14O5 |
| Molecular Weight | 178.18 |
| CAS Registry Number | 69351-79-7 |
| SMILES | [C@@](C)([C@H](C=O)O)(O)[C@@H](O)[C@H](O)C |
| InChI | 1S/C7H14O5/c1-4(9)6(11)7(2,12)5(10)3-8/h3-6,9-12H,1-2H3/t4-,5+,6+,7+/m1/s1 |
| InChIKey | AWWDAEYRNORHRF-BWBBJGPYSA-N |
| Density | 1.344g/cm3 (Cal.) |
|---|---|
| Boiling point | 391.132°C at 760 mmHg (Cal.) |
| Flash point | 204.517°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Deoxy-3-C-methyl-D-Gulose |