Online Database of Chemicals from Around the World
|
CAS#: 6938-53-0 Product: 1,3-Benzodioxole-5-carboxylic anhydride No suppilers available for the product. |
| Name | 1,3-Benzodioxole-5-carboxylic anhydride |
|---|---|
| Synonyms | 1,3-Benzodioxole-5-Carboxylic Acid (1,3-Benzodioxol-5-Yl-Oxomethyl) Ester; 1,3-Benzodioxole-5-Carboxylic Acid 1,3-Benzodioxole-5-Carbonyl Ester; 1,3-Benzodioxol-5-Ylcarbonyl 1,3-Benzodioxole-5-Carboxylate |
| Molecular Structure |  |
| Molecular Formula | C16H10O7 |
| Molecular Weight | 314.25 |
| CAS Registry Number | 6938-53-0 |
| SMILES | C1=CC(=CC2=C1OCO2)C(=O)OC(=O)C4=CC3=C(OCO3)C=C4 |
| InChI | 1S/C16H10O7/c17-15(9-1-3-11-13(5-9)21-7-19-11)23-16(18)10-2-4-12-14(6-10)22-8-20-12/h1-6H,7-8H2 |
| InChIKey | FEMUTVSKHVSGSR-UHFFFAOYSA-N |
| Density | 1.503g/cm3 (Cal.) |
|---|---|
| Boiling point | 526.833°C at 760 mmHg (Cal.) |
| Flash point | 237.223°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Benzodioxole-5-carboxylic anhydride |