|
CAS#: 69381-94-8 Product: Fenprostalene No suppilers available for the product. |
| Name | Fenprostalene |
|---|---|
| Synonyms | 7-[(1R,3R,5S)-3,5-Dihydroxy-2-[(E,3R)-3-Hydroxy-4-(Phenoxy)But-1-Enyl]Cyclopentyl]Hepta-4,5-Dienoic Acid Methyl Ester; D04160; Fenprostalene (Usan) |
| Molecular Structure | ![]() |
| Molecular Formula | C23H30O6 |
| Molecular Weight | 402.49 |
| CAS Registry Number | 69381-94-8 |
| EINECS | 273-982-3 |
| SMILES | [C@H]1(C([C@H](O)C[C@@H]1O)\C=C\[C@@H](O)COC2=CC=CC=C2)C[CH]=[C]=[CH]CCC(OC)=O |
| InChI | 1S/C23H30O6/c1-28-23(27)12-8-3-2-7-11-19-20(22(26)15-21(19)25)14-13-17(24)16-29-18-9-5-4-6-10-18/h3-7,9-10,13-14,17,19-22,24-26H,8,11-12,15-16H2,1H3/b14-13+/t2?,17-,19-,20?,21+,22-/m1/s1 |
| InChIKey | BYNHBQROLKAEDQ-PASQQFGNSA-N |
| Density | 1.206g/cm3 (Cal.) |
|---|---|
| Boiling point | 553.855°C at 760 mmHg (Cal.) |
| Flash point | 185.238°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Fenprostalene |