|
CAS#: 69405-49-8 Product: 4-Dipropylamino-3-Nitro-1-Thiocoumarin No suppilers available for the product. |
| Name | 4-Dipropylamino-3-Nitro-1-Thiocoumarin |
|---|---|
| Synonyms | 4-(Dipropylamino)-3-Nitro-Thiochromen-2-One; 4-(Dipropylamino)-3-Nitro-2-Thiochromenone; Oprea1_487273 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.38 |
| CAS Registry Number | 69405-49-8 |
| SMILES | C1=C2C(=CC=C1)SC(C(=C2N(CCC)CCC)[N+](=O)[O-])=O |
| InChI | 1S/C15H18N2O3S/c1-3-9-16(10-4-2)13-11-7-5-6-8-12(11)21-15(18)14(13)17(19)20/h5-8H,3-4,9-10H2,1-2H3 |
| InChIKey | IWHCRBBRAJTUNV-UHFFFAOYSA-N |
| Density | 1.271g/cm3 (Cal.) |
|---|---|
| Boiling point | 381.954°C at 760 mmHg (Cal.) |
| Flash point | 184.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Dipropylamino-3-Nitro-1-Thiocoumarin |