Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3-Ethyl-7-(3-pyrrolidinyl)quinoline |
|---|---|
| Synonyms | 3-ethyl-7-(pyrrolidin-3-yl)quinoline |
| Molecular Structure |  |
| Molecular Formula | C15H18N2 |
| Molecular Weight | 226.32 |
| CAS Registry Number | 695185-28-5 |
| SMILES | n3c1c(ccc(c1)C2CCNC2)cc(c3)CC |
| InChI | 1S/C15H18N2/c1-2-11-7-13-4-3-12(8-15(13)17-9-11)14-5-6-16-10-14/h3-4,7-9,14,16H,2,5-6,10H2,1H3 |
| InChIKey | XBRBPJXZCRGOJD-UHFFFAOYSA-N |
| Density | 1.082g/cm3 (Cal.) |
|---|---|
| Boiling point | 386.233°C at 760 mmHg (Cal.) |
| Flash point | 187.387°C (Cal.) |
| Refractive index | 1.602 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Ethyl-7-(3-pyrrolidinyl)quinoline |