Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 2,3-Dihydro-5-Nitroimidazo(2,1-b)Oxazole |
|---|---|
| Synonyms | 5-Nitro-2,3-Dihydroimidazo[2,1-B]Oxazole; Ka 151; Ka-151 |
| Molecular Structure |  |
| Molecular Formula | C5H5N3O3 |
| Molecular Weight | 155.11 |
| CAS Registry Number | 69542-88-7 |
| SMILES | C1=C([N]2C(=N1)OCC2)[N+]([O-])=O |
| InChI | 1S/C5H5N3O3/c9-8(10)4-3-6-5-7(4)1-2-11-5/h3H,1-2H2 |
| InChIKey | CYWFJXPMXFMCOF-UHFFFAOYSA-N |
| Density | 1.863g/cm3 (Cal.) |
|---|---|
| Boiling point | 348.149°C at 760 mmHg (Cal.) |
| Flash point | 164.355°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dihydro-5-Nitroimidazo(2,1-b)Oxazole |