Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Beta Pharma Scientific, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (203) 315-5062 / (877) 786-1922 | |||
|
sales@betapharma.com, | |||
| Chemical manufacturer | ||||
| Name | 1-[3-(3,5-Dichlorophenoxy)phenyl]methanamine |
|---|---|
| Synonyms | 1-[3-(3,5-Dichlorophenoxy)phenyl]methanamine; 1-[3-(3,5-Dichlorophénoxy)phényl]méthanamine; 1-[3-(3,5-Dichlorphenoxy)phenyl]methanamin |
| Molecular Structure | ![CAS#: 696581-41-6， 1-[3-(3,5-Dichlorophenoxy)phenyl]methanamine](/moreStructures/696581-41-6.gif) |
| Molecular Formula | C13H11Cl2NO |
| Molecular Weight | 268.14 |
| CAS Registry Number | 696581-41-6 |
| SMILES | c1cc(cc(c1)Oc2cc(cc(c2)Cl)Cl)CN |
| InChI | 1S/C13H11Cl2NO/c14-10-5-11(15)7-13(6-10)17-12-3-1-2-9(4-12)8-16/h1-7H,8,16H2 |
| InChIKey | AHPZRSMHPDZNEJ-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 379.8±42.0°C at 760 mmHg (Cal.) |
| Flash point | 183.5±27.9°C (Cal.) |
| Refractive index | 1.613 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[3-(3,5-Dichlorophenoxy)phenyl]methanamine |