Online Database of Chemicals from Around the World
|
CAS#: 6973-95-1 Product: 3-Bis(3-Aminophenyl)Arsanylaniline No suppilers available for the product. |
| Name | 3-Bis(3-Aminophenyl)Arsanylaniline |
|---|---|
| Synonyms | [3-Bis(3-Aminophenyl)Arsanylphenyl]Amine; Antineoplastic-41386; Nsc41386 |
| Molecular Structure |  |
| Molecular Formula | C18H18AsN3 |
| Molecular Weight | 351.28 |
| CAS Registry Number | 6973-95-1 |
| SMILES | C3=C(C=C([As](C1=CC(=CC=C1)N)C2=CC(=CC=C2)N)C=C3)N |
| InChI | 1S/C18H18AsN3/c20-16-7-1-4-13(10-16)19(14-5-2-8-17(21)11-14)15-6-3-9-18(22)12-15/h1-12H,20-22H2 |
| InChIKey | BJWMOYRXHSATCG-UHFFFAOYSA-N |
| Boiling point | 563.055°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 331.959°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Bis(3-Aminophenyl)Arsanylaniline |