Online Database of Chemicals from Around the World
|
CAS#: 6974-95-4 Product: 4-[(1-Methylpyrrol-2-Yl)Methyl]Morpholine No suppilers available for the product. |
| Name | 4-[(1-Methylpyrrol-2-Yl)Methyl]Morpholine |
|---|---|
| Synonyms | 4-[(1-Methyl-2-Pyrrolyl)Methyl]Morpholine; Nsc22048 |
| Molecular Structure | ![CAS#: 6974-95-4， 4-[(1-Methylpyrrol-2-Yl)Methyl]Morpholine](/moreStructures/6974-95-4.gif) |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 |
| CAS Registry Number | 6974-95-4 |
| SMILES | C1=C([N](C)C=C1)CN2CCOCC2 |
| InChI | 1S/C10H16N2O/c1-11-4-2-3-10(11)9-12-5-7-13-8-6-12/h2-4H,5-9H2,1H3 |
| InChIKey | ZPPCOAPTXYJLTG-UHFFFAOYSA-N |
| Density | 1.101g/cm3 (Cal.) |
|---|---|
| Boiling point | 271.764°C at 760 mmHg (Cal.) |
| Flash point | 118.159°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[(1-Methylpyrrol-2-Yl)Methyl]Morpholine |