Online Database of Chemicals from Around the World
|
CAS#: 69797-51-9 Product: 4-Methylsulfonyl-2,3',4',5-Tetrachlorobiphenyl No suppilers available for the product. |
| Name | 4-Methylsulfonyl-2,3',4',5-Tetrachlorobiphenyl |
|---|---|
| Synonyms | 1,4-Dichloro-2-(3,4-Dichlorophenyl)-5-Methylsulfonyl-Benzene; 1,4-Dichloro-2-(3,4-Dichlorophenyl)-5-Mesyl-Benzene; 2,5,3',4'-Tetrachloro-4-(Methylsulfonyl)-1,1'-Biphenyl |
| Molecular Structure |  |
| Molecular Formula | C13H8Cl4O2S |
| Molecular Weight | 370.08 |
| CAS Registry Number | 69797-51-9 |
| SMILES | C1=C(C(=CC(=C1[S](=O)(=O)C)Cl)C2=CC=C(C(=C2)Cl)Cl)Cl |
| InChI | 1S/C13H8Cl4O2S/c1-20(18,19)13-6-10(15)8(5-12(13)17)7-2-3-9(14)11(16)4-7/h2-6H,1H3 |
| InChIKey | JQUKTDLZMGSALF-UHFFFAOYSA-N |
| Density | 1.515g/cm3 (Cal.) |
|---|---|
| Boiling point | 503.239°C at 760 mmHg (Cal.) |
| Flash point | 258.15°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methylsulfonyl-2,3',4',5-Tetrachlorobiphenyl |