Online Database of Chemicals from Around the World
|
CAS#: 69809-24-1 Product: 5,8-Dihydroxy-2-(2-Phenylethyl)Chromone No suppilers available for the product. |
| Name | 5,8-Dihydroxy-2-(2-Phenylethyl)Chromone |
|---|---|
| Synonyms | 5,8-Dihydroxy-2-(2-Phenylethyl)-4-Chromenone; 5,8-Dihydroxy-2-(2-Phenylethyl)Chromone; Dpec |
| Molecular Structure |  |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.30 |
| CAS Registry Number | 69809-24-1 |
| SMILES | C3=C(C1=C(OC(=CC1=O)CCC2=CC=CC=C2)C(=C3)O)O |
| InChI | 1S/C17H14O4/c18-13-8-9-14(19)17-16(13)15(20)10-12(21-17)7-6-11-4-2-1-3-5-11/h1-5,8-10,18-19H,6-7H2 |
| InChIKey | NKMJZJDVLMDPGO-UHFFFAOYSA-N |
| Density | 1.343g/cm3 (Cal.) |
|---|---|
| Boiling point | 509.174°C at 760 mmHg (Cal.) |
| Flash point | 192.261°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,8-Dihydroxy-2-(2-Phenylethyl)Chromone |