Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-Ethyl-5-methoxy-3,3-dimethyl-2-methyleneindoline |
|---|---|
| Synonyms | 1-ethyl-5-methoxy-3,3-dimethyl-2-methyleneindoline |
| Molecular Structure |  |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 |
| CAS Registry Number | 698387-65-4 |
| SMILES | COc1cc2c(cc1)N(CC)C(=C)C2(C)C |
| InChI | 1S/C14H19NO/c1-6-15-10(2)14(3,4)12-9-11(16-5)7-8-13(12)15/h7-9H,2,6H2,1,3-5H3 |
| InChIKey | GPIUUHHSYVVTOT-UHFFFAOYSA-N |
| Density | 1.034g/cm3 (Cal.) |
|---|---|
| Boiling point | 319.335°C at 760 mmHg (Cal.) |
| Flash point | 94.318°C (Cal.) |
| Refractive index | 1.55 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Ethyl-5-methoxy-3,3-dimethyl-2-methyleneindoline |