Online Database of Chemicals from Around the World
| Carbosynth China Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (512) 6260-5585 | |||
 |
sales@carbosynth.com | |||
 |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2016 | ||||
| Name | Olivose |
|---|---|
| Synonyms | Olivose |
| Molecular Structure |  |
| Molecular Formula | C6H14O4 |
| Molecular Weight | 150.17 |
| CAS Registry Number | 6988-55-2 |
| SMILES | [C@H](O)([C@H](O)[C@H](O)C)CCO |
| InChI | 1S/C6H14O4/c1-4(8)6(10)5(9)2-3-7/h4-10H,2-3H2,1H3/t4-,5-,6-/m1/s1 |
| InChIKey | XKYZEKVVQZGXOJ-HSUXUTPPSA-N |
| Density | 1.265g/cm3 (Cal.) |
|---|---|
| Boiling point | 389.673°C at 760 mmHg (Cal.) |
| Flash point | 202.115°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Olivose |