Online Database of Chemicals from Around the World
|
CAS#: 69881-92-1 Product: 2,3,6,7-Tetrabromonaphthalene No suppilers available for the product. |
| Name | 2,3,6,7-Tetrabromonaphthalene |
|---|---|
| Synonyms | Naphthalene, 2,3,6,7-Tetrabromo- |
| Molecular Structure |  |
| Molecular Formula | C10H4Br4 |
| Molecular Weight | 443.76 |
| CAS Registry Number | 69881-92-1 |
| SMILES | C1=C(C(=CC2=C1C=C(C(=C2)Br)Br)Br)Br |
| InChI | 1S/C10H4Br4/c11-7-1-5-2-9(13)10(14)4-6(5)3-8(7)12/h1-4H |
| InChIKey | ZWEYMNHQUMTRGY-UHFFFAOYSA-N |
| Density | 2.357g/cm3 (Cal.) |
|---|---|
| Boiling point | 445.723°C at 760 mmHg (Cal.) |
| Flash point | 215.66°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,6,7-Tetrabromonaphthalene |