Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 5,6-Dihydro-3-Methyl-N-Phenyl-1,4-Oxathiin-2-Carboxamide |
|---|---|
| Synonyms | 1,4-Oxathiin-2-Carboxamide, 5,6-Dihydro-3-Methyl-N-Phenyl-; 5,6-Dihydro-3-Methyl-N-Phenyl-1,4-Oxathiin-2-Carboxamide |
| Molecular Structure |  |
| Molecular Formula | C12H13NO2S |
| Molecular Weight | 235.30 |
| CAS Registry Number | 69892-02-0 |
| SMILES | C2=C(NC(=O)C1=C(SCCO1)C)C=CC=C2 |
| InChI | 1S/C12H13NO2S/c1-9-11(15-7-8-16-9)12(14)13-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3,(H,13,14) |
| InChIKey | OOIDFJFYUCFPCH-UHFFFAOYSA-N |
| Density | 1.273g/cm3 (Cal.) |
|---|---|
| Boiling point | 420.567°C at 760 mmHg (Cal.) |
| Flash point | 208.152°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,6-Dihydro-3-Methyl-N-Phenyl-1,4-Oxathiin-2-Carboxamide |