Online Database of Chemicals from Around the World
|
CAS#: 69943-47-1 Product: (2-Chloro-4-Fluorophenyl)Phenylmethanone No suppilers available for the product. |
| Name | (2-Chloro-4-Fluorophenyl)Phenylmethanone |
|---|---|
| Synonyms | (2-Chloro-4-Fluoro-Phenyl)-Phenyl-Methanone; Methanone, (2-Chloro-4-Fluorophenyl)Phenyl- |
| Molecular Structure |  |
| Molecular Formula | C13H8ClFO |
| Molecular Weight | 234.66 |
| CAS Registry Number | 69943-47-1 |
| SMILES | C1=C(F)C=CC(=C1Cl)C(=O)C2=CC=CC=C2 |
| InChI | 1S/C13H8ClFO/c14-12-8-10(15)6-7-11(12)13(16)9-4-2-1-3-5-9/h1-8H |
| InChIKey | DIUCEDHZWIRJDI-UHFFFAOYSA-N |
| Density | 1.277g/cm3 (Cal.) |
|---|---|
| Boiling point | 332.191°C at 760 mmHg (Cal.) |
| Flash point | 154.704°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2-Chloro-4-Fluorophenyl)Phenylmethanone |